C23H42O4SSi2 — CID 134946760
triethyl-[(2S,3S,4S,5R,6S)-5-methoxy-2,4-dimethyl-6-phenylsulfanyl-4-trimethylsilyloxyoxan-3-yl]oxysilane (PubChem CID 134946760) has the molecular formula C23H42O4SSi2 and a molecular weight of 470.82 g/mol. Its IUPAC name is triethyl-[(2S,3S,4S,5R,6S)-5-methoxy-2,4-dimethyl-6-phenylsulfanyl-4-trimethylsilyloxyoxan-3-yl]oxysilane.
| Compound Name | triethyl-[(2S,3S,4S,5R,6S)-5-methoxy-2,4-dimethyl-6-phenylsulfanyl-4-trimethylsilyloxyoxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 134946760 |
| Molecular Formula | C23H42O4SSi2 |
| Molecular Weight | 470.82 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | triethyl-[(2S,3S,4S,5R,6S)-5-methoxy-2,4-dimethyl-6-phenylsulfanyl-4-trimethylsilyloxyoxan-3-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H](C)O[C@@H](Sc2ccccc2)[C@H](OC)[C@]1(C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H42O4SSi2/c1-10-30(11-2,12-3)26-20-18(4)25-22(28-19-16-14-13-15-17-19)21(24-6)23(20,5)27-29(7,8)9/h13-18,20-22H,10-12H2,1-9H3/t18-,20-,21-,22-,23+/m0/s1 |
| InChIKey | XJRLKWGATLUHBN-VPSDZCSPSA-N |
| XLogP | 6.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.82 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|