C29H50O4SSi2 — CID 102212916
[(4aR,8R,8aR)-2,2-ditert-butyl-6-phenylsulfanyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-tri(propan-2-yl)silane (PubChem CID 102212916) has the molecular formula C29H50O4SSi2 and a molecular weight of 550.95 g/mol. Its IUPAC name is [(4aR,8R,8aR)-2,2-ditert-butyl-6-phenylsulfanyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(4aR,8R,8aR)-2,2-ditert-butyl-6-phenylsulfanyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102212916 |
| Molecular Formula | C29H50O4SSi2 |
| Molecular Weight | 550.95 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | [(4aR,8R,8aR)-2,2-ditert-butyl-6-phenylsulfanyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H]1C=C(Sc2ccccc2)O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H50O4SSi2/c1-20(2)35(21(3)4,22(5)6)32-24-18-26(34-23-16-14-13-15-17-23)31-25-19-30-36(28(7,8)9,29(10,11)12)33-27(24)25/h13-18,20-22,24-25,27H,19H2,1-12H3/t24-,25-,27+/m1/s1 |
| InChIKey | NUMHFBCSLRINTR-SLQPCKNISA-N |
| XLogP | 9.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.95 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|