C29H56O4SSi3 — CID 134974887
[(2R,3S,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134974887) has the molecular formula C29H56O4SSi3 and a molecular weight of 585.09 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134974887 |
| Molecular Formula | C29H56O4SSi3 |
| Molecular Weight | 585.09 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | [(2R,3S,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylsulfanyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)CO[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C29H56O4SSi3/c1-27(2,3)35(10,11)31-23-21-30-26(34-22-19-17-16-18-20-22)25(33-37(14,15)29(7,8)9)24(23)32-36(12,13)28(4,5)6/h16-20,23-26H,21H2,1-15H3/t23-,24-,25+,26-/m1/s1 |
| InChIKey | MUGKIRLCPQYQCI-FXSWLTOZSA-N |
| XLogP | 9.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.09 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|