C19H32O4SSi — CID 10762622
4-[(E)-2-(benzenesulfonyl)ethenoxy]pentoxy-tert-butyl-dimethylsilane (PubChem CID 10762622) has the molecular formula C19H32O4SSi and a molecular weight of 384.61 g/mol. Its IUPAC name is 4-[(E)-2-(benzenesulfonyl)ethenoxy]pentoxy-tert-butyl-dimethylsilane.
| Compound Name | 4-[(E)-2-(benzenesulfonyl)ethenoxy]pentoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10762622 |
| Molecular Formula | C19H32O4SSi |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[(E)-2-(benzenesulfonyl)ethenoxy]pentoxy-tert-butyl-dimethylsilane |
| SMILES | CC(CCCO[Si](C)(C)C(C)(C)C)O/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H32O4SSi/c1-17(11-10-14-23-25(5,6)19(2,3)4)22-15-16-24(20,21)18-12-8-7-9-13-18/h7-9,12-13,15-17H,10-11,14H2,1-6H3/b16-15+ |
| InChIKey | DJUSCPSGLYCEIY-FOCLMDBBSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|