C17H28O3SSi — CID 162405619
[(E)-5-(benzenesulfonyl)pent-4-enoxy]-tert-butyl-dimethylsilane (PubChem CID 162405619) has the molecular formula C17H28O3SSi and a molecular weight of 340.56 g/mol. Its IUPAC name is [(E)-5-(benzenesulfonyl)pent-4-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E)-5-(benzenesulfonyl)pent-4-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162405619 |
| Molecular Formula | C17H28O3SSi |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(E)-5-(benzenesulfonyl)pent-4-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H28O3SSi/c1-17(2,3)22(4,5)20-14-10-7-11-15-21(18,19)16-12-8-6-9-13-16/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b15-11+ |
| InChIKey | NQJUPZKXUCIBMW-RVDMUPIBSA-N |
| XLogP | 4.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|