C17H26O3SSi — CID 11602512
[(1R,2R)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxy-tert-butyl-dimethylsilane (PubChem CID 11602512) has the molecular formula C17H26O3SSi and a molecular weight of 338.55 g/mol. Its IUPAC name is [(1R,2R)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11602512 |
| Molecular Formula | C17H26O3SSi |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(1R,2R)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]1/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26O3SSi/c1-17(2,3)22(4,5)20-16-13-14(16)11-12-21(18,19)15-9-7-6-8-10-15/h6-12,14,16H,13H2,1-5H3/b12-11+/t14-,16+/m0/s1 |
| InChIKey | HCIJHDGJCVOVPG-IXVOVUJJSA-N |
| XLogP | 4.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|