C20H34O4SSi — CID 10548912
5-[(E)-2-(benzenesulfonyl)ethenoxy]hexoxy-tert-butyl-dimethylsilane (PubChem CID 10548912) has the molecular formula C20H34O4SSi and a molecular weight of 398.64 g/mol. Its IUPAC name is 5-[(E)-2-(benzenesulfonyl)ethenoxy]hexoxy-tert-butyl-dimethylsilane.
| Compound Name | 5-[(E)-2-(benzenesulfonyl)ethenoxy]hexoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10548912 |
| Molecular Formula | C20H34O4SSi |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 5-[(E)-2-(benzenesulfonyl)ethenoxy]hexoxy-tert-butyl-dimethylsilane |
| SMILES | CC(CCCCO[Si](C)(C)C(C)(C)C)O/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H34O4SSi/c1-18(12-10-11-15-24-26(5,6)20(2,3)4)23-16-17-25(21,22)19-13-8-7-9-14-19/h7-9,13-14,16-18H,10-12,15H2,1-6H3/b17-16+ |
| InChIKey | DXENVOWDRZVDGD-WUKNDPDISA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|