C22H36O3SSi — CID 11069577
[(4R,7E)-9-(benzenesulfonyl)-7-methylnona-1,7-dien-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11069577) has the molecular formula C22H36O3SSi and a molecular weight of 408.68 g/mol. Its IUPAC name is [(4R,7E)-9-(benzenesulfonyl)-7-methylnona-1,7-dien-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,7E)-9-(benzenesulfonyl)-7-methylnona-1,7-dien-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11069577 |
| Molecular Formula | C22H36O3SSi |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [(4R,7E)-9-(benzenesulfonyl)-7-methylnona-1,7-dien-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@H](CC/C(C)=C/CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O3SSi/c1-8-12-20(25-27(6,7)22(3,4)5)16-15-19(2)17-18-26(23,24)21-13-10-9-11-14-21/h8-11,13-14,17,20H,1,12,15-16,18H2,2-7H3/b19-17+/t20-/m0/s1 |
| InChIKey | UISLSIARHWBFEV-XJZVHDHVSA-N |
| XLogP | 6.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|