C27H46O4SSi — CID 14704706
(2R,3S,6E)-5-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-3-ol (PubChem CID 14704706) has the molecular formula C27H46O4SSi and a molecular weight of 494.81 g/mol. Its IUPAC name is (2R,3S,6E)-5-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-3-ol.
| Compound Name | (2R,3S,6E)-5-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-3-ol |
|---|---|
| PubChem CID | 14704706 |
| Molecular Formula | C27H46O4SSi |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (2R,3S,6E)-5-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-3-ol |
| SMILES | CC(C)=CCC/C(C)=C/C(C[C@](C)(O)[C@@H](C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H46O4SSi/c1-21(2)15-14-16-22(3)19-25(32(29,30)24-17-12-11-13-18-24)20-27(8,28)23(4)31-33(9,10)26(5,6)7/h11-13,15,17-19,23,25,28H,14,16,20H2,1-10H3/b22-19+/t23-,25?,27+/m1/s1 |
| InChIKey | ZMYYGCMUHBKBND-ZMLLGCKPSA-N |
| XLogP | 7.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|