C21H34O4SSi — CID 102323731
(1R,2S,6R,7R)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol (PubChem CID 102323731) has the molecular formula C21H34O4SSi and a molecular weight of 410.65 g/mol. Its IUPAC name is (1R,2S,6R,7R)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol.
| Compound Name | (1R,2S,6R,7R)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 102323731 |
| Molecular Formula | C21H34O4SSi |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (1R,2S,6R,7R)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-ol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](C)C(S(=O)(=O)c2ccccc2)=CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O4SSi/c1-15-18(25-27(6,7)21(3,4)5)13-14-19(16(2)20(15)22)26(23,24)17-11-9-8-10-12-17/h8-12,14-16,18,20,22H,13H2,1-7H3/t15-,16+,18+,20+/m0/s1 |
| InChIKey | JRZIUDZGZOPNFZ-IXIUHKBRSA-N |
| XLogP | 4.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|