C16H24O3S — CID 14891593
(3R,4S)-2-(benzenesulfonyl)-3-methylnon-1-en-4-ol (PubChem CID 14891593) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is (3R,4S)-2-(benzenesulfonyl)-3-methylnon-1-en-4-ol.
| Compound Name | (3R,4S)-2-(benzenesulfonyl)-3-methylnon-1-en-4-ol |
|---|---|
| PubChem CID | 14891593 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3R,4S)-2-(benzenesulfonyl)-3-methylnon-1-en-4-ol |
| SMILES | C=C([C@H](C)[C@@H](O)CCCCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24O3S/c1-4-5-7-12-16(17)13(2)14(3)20(18,19)15-10-8-6-9-11-15/h6,8-11,13,16-17H,3-5,7,12H2,1-2H3/t13-,16-/m0/s1 |
| InChIKey | NROMTMFUHSPSHS-BBRMVZONSA-N |
| XLogP | 3.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|