C17H24O3S — CID 134931126
(1S,2R)-3-(benzenesulfonyl)-1-cyclohexyl-2-methylbut-3-en-1-ol (PubChem CID 134931126) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is (1S,2R)-3-(benzenesulfonyl)-1-cyclohexyl-2-methylbut-3-en-1-ol.
| Compound Name | (1S,2R)-3-(benzenesulfonyl)-1-cyclohexyl-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 134931126 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (1S,2R)-3-(benzenesulfonyl)-1-cyclohexyl-2-methylbut-3-en-1-ol |
| SMILES | C=C([C@H](C)[C@@H](O)C1CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24O3S/c1-13(17(18)15-9-5-3-6-10-15)14(2)21(19,20)16-11-7-4-8-12-16/h4,7-8,11-13,15,17-18H,2-3,5-6,9-10H2,1H3/t13-,17+/m0/s1 |
| InChIKey | RRHCKWLAZFZCMM-SUMWQHHRSA-N |
| XLogP | 3.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |