C19H23FO5S2 — CID 101483657
(3R)-3-[bis(benzenesulfonyl)-fluoromethyl]hexan-1-ol (PubChem CID 101483657) has the molecular formula C19H23FO5S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]hexan-1-ol.
| Compound Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]hexan-1-ol |
|---|---|
| PubChem CID | 101483657 |
| Molecular Formula | C19H23FO5S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]hexan-1-ol |
| SMILES | CCC[C@H](CCO)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23FO5S2/c1-2-9-16(14-15-21)19(20,26(22,23)17-10-5-3-6-11-17)27(24,25)18-12-7-4-8-13-18/h3-8,10-13,16,21H,2,9,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | DETKYCYPTDKENU-MRXNPFEDSA-N |
| XLogP | 3.36 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |