C20H23FO6S2 — CID 135019281
(3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanoic acid (PubChem CID 135019281) has the molecular formula C20H23FO6S2 and a molecular weight of 442.53 g/mol. Its IUPAC name is (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanoic acid.
| Compound Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanoic acid |
|---|---|
| PubChem CID | 135019281 |
| Molecular Formula | C20H23FO6S2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanoic acid |
| SMILES | CCCC[C@H](CC(=O)O)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23FO6S2/c1-2-3-10-16(15-19(22)23)20(21,28(24,25)17-11-6-4-7-12-17)29(26,27)18-13-8-5-9-14-18/h4-9,11-14,16H,2-3,10,15H2,1H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | AWIBWSSQSGLPEZ-MRXNPFEDSA-N |
| XLogP | 3.84 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |