C19H21FO5S2 — CID 135070601
4-[bis(benzenesulfonyl)-fluoromethyl]hexan-2-one (PubChem CID 135070601) has the molecular formula C19H21FO5S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 4-[bis(benzenesulfonyl)-fluoromethyl]hexan-2-one.
| Compound Name | 4-[bis(benzenesulfonyl)-fluoromethyl]hexan-2-one |
|---|---|
| PubChem CID | 135070601 |
| Molecular Formula | C19H21FO5S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-[bis(benzenesulfonyl)-fluoromethyl]hexan-2-one |
| SMILES | CCC(CC(C)=O)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21FO5S2/c1-3-16(14-15(2)21)19(20,26(22,23)17-10-6-4-7-11-17)27(24,25)18-12-8-5-9-13-18/h4-13,16H,3,14H2,1-2H3 |
| InChIKey | RSHBNQFMMXHUJG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |