C18H19FO5S2 — CID 135070963
3-[bis(benzenesulfonyl)-fluoromethyl]pentanal (PubChem CID 135070963) has the molecular formula C18H19FO5S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-[bis(benzenesulfonyl)-fluoromethyl]pentanal.
| Compound Name | 3-[bis(benzenesulfonyl)-fluoromethyl]pentanal |
|---|---|
| PubChem CID | 135070963 |
| Molecular Formula | C18H19FO5S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-[bis(benzenesulfonyl)-fluoromethyl]pentanal |
| SMILES | CCC(CC=O)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19FO5S2/c1-2-15(13-14-20)18(19,25(21,22)16-9-5-3-6-10-16)26(23,24)17-11-7-4-8-12-17/h3-12,14-15H,2,13H2,1H3 |
| InChIKey | ARJFJMDXUFHENN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|