C22H19FO5S2 — CID 135060781
(3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbutanal (PubChem CID 135060781) has the molecular formula C22H19FO5S2 and a molecular weight of 446.52 g/mol. Its IUPAC name is (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbutanal.
| Compound Name | (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbutanal |
|---|---|
| PubChem CID | 135060781 |
| Molecular Formula | C22H19FO5S2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbutanal |
| SMILES | O=CC[C@@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19FO5S2/c23-22(29(25,26)19-12-6-2-7-13-19,30(27,28)20-14-8-3-9-15-20)21(16-17-24)18-10-4-1-5-11-18/h1-15,17,21H,16H2/t21-/m0/s1 |
| InChIKey | RYWHMFVXZNIAFO-NRFANRHFSA-N |
| XLogP | 3.93 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|