C17H17FO5S2 — CID 135061127
(3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methylbutanal (PubChem CID 135061127) has the molecular formula C17H17FO5S2 and a molecular weight of 384.45 g/mol. Its IUPAC name is (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methylbutanal.
| Compound Name | (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methylbutanal |
|---|---|
| PubChem CID | 135061127 |
| Molecular Formula | C17H17FO5S2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methylbutanal |
| SMILES | C[C@H](CC=O)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17FO5S2/c1-14(12-13-19)17(18,24(20,21)15-8-4-2-5-9-15)25(22,23)16-10-6-3-7-11-16/h2-11,13-14H,12H2,1H3/t14-/m1/s1 |
| InChIKey | BEVAVOQMYWWWEH-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|