C19H19FO4S2 — CID 44519651
[(E,2S)-1-(benzenesulfonyl)-2-ethenyl-1-fluoropent-3-enyl]sulfonylbenzene (PubChem CID 44519651) has the molecular formula C19H19FO4S2 and a molecular weight of 394.49 g/mol. Its IUPAC name is [(E,2S)-1-(benzenesulfonyl)-2-ethenyl-1-fluoropent-3-enyl]sulfonylbenzene.
| Compound Name | [(E,2S)-1-(benzenesulfonyl)-2-ethenyl-1-fluoropent-3-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 44519651 |
| Molecular Formula | C19H19FO4S2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [(E,2S)-1-(benzenesulfonyl)-2-ethenyl-1-fluoropent-3-enyl]sulfonylbenzene |
| SMILES | C=C[C@@H](/C=C/C)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19FO4S2/c1-3-11-16(4-2)19(20,25(21,22)17-12-7-5-8-13-17)26(23,24)18-14-9-6-10-15-18/h3-16H,2H2,1H3/b11-3+/t16-/m0/s1 |
| InChIKey | FCSPOMSBHFPEID-WPGNYUKHSA-N |
| XLogP | 3.94 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|