C20H23FO5S2 — CID 135019279
(3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanal (PubChem CID 135019279) has the molecular formula C20H23FO5S2 and a molecular weight of 426.53 g/mol. Its IUPAC name is (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanal.
| Compound Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanal |
|---|---|
| PubChem CID | 135019279 |
| Molecular Formula | C20H23FO5S2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]heptanal |
| SMILES | CCCC[C@H](CC=O)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23FO5S2/c1-2-3-10-17(15-16-22)20(21,27(23,24)18-11-6-4-7-12-18)28(25,26)19-13-8-5-9-14-19/h4-9,11-14,16-17H,2-3,10,15H2,1H3/t17-/m1/s1 |
| InChIKey | VENHZWRIIYLRHQ-QGZVFWFLSA-N |
| XLogP | 3.95 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|