C19H19FO5S2 — CID 101477173
(3R)-3-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-one (PubChem CID 101477173) has the molecular formula C19H19FO5S2 and a molecular weight of 410.49 g/mol. Its IUPAC name is (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-one.
| Compound Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 101477173 |
| Molecular Formula | C19H19FO5S2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (3R)-3-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-one |
| SMILES | O=C1CCC[C@@H](C(F)(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C19H19FO5S2/c20-19(15-8-7-9-16(21)14-15,26(22,23)17-10-3-1-4-11-17)27(24,25)18-12-5-2-6-13-18/h1-6,10-13,15H,7-9,14H2/t15-/m1/s1 |
| InChIKey | RIIJTPFZMYCTID-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |