C14H13F3O3S — CID 134852679
1-[6-(benzenesulfonyl)cyclohex-3-en-1-yl]-2,2,2-trifluoroethanone (PubChem CID 134852679) has the molecular formula C14H13F3O3S and a molecular weight of 318.32 g/mol. Its IUPAC name is 1-[6-(benzenesulfonyl)cyclohex-3-en-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[6-(benzenesulfonyl)cyclohex-3-en-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 134852679 |
| Molecular Formula | C14H13F3O3S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-[6-(benzenesulfonyl)cyclohex-3-en-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(C1CC=CCC1S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O3S/c15-14(16,17)13(18)11-8-4-5-9-12(11)21(19,20)10-6-2-1-3-7-10/h1-7,11-12H,8-9H2 |
| InChIKey | BTAPLOVVDZJAHI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|