C17H23FO3S — CID 134968160
(Z)-5-cyclohexyl-5-(4-fluorophenyl)sulfonylpent-3-en-1-ol (PubChem CID 134968160) has the molecular formula C17H23FO3S and a molecular weight of 326.43 g/mol. Its IUPAC name is (Z)-5-cyclohexyl-5-(4-fluorophenyl)sulfonylpent-3-en-1-ol.
| Compound Name | (Z)-5-cyclohexyl-5-(4-fluorophenyl)sulfonylpent-3-en-1-ol |
|---|---|
| PubChem CID | 134968160 |
| Molecular Formula | C17H23FO3S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (Z)-5-cyclohexyl-5-(4-fluorophenyl)sulfonylpent-3-en-1-ol |
| SMILES | O=S(=O)(c1ccc(F)cc1)C(/C=C\CCO)C1CCCCC1 |
| InChI | InChI=1S/C17H23FO3S/c18-15-9-11-16(12-10-15)22(20,21)17(8-4-5-13-19)14-6-2-1-3-7-14/h4,8-12,14,17,19H,1-3,5-7,13H2/b8-4- |
| InChIKey | KCCNTNDQEHNSMJ-YWEYNIOJSA-N |
| XLogP | 3.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|