C17H19FO3S — CID 164685184
(2S)-2-[(4-fluorophenyl)sulfonyl-phenylmethyl]butan-1-ol (PubChem CID 164685184) has the molecular formula C17H19FO3S and a molecular weight of 322.40 g/mol. Its IUPAC name is (2S)-2-[(4-fluorophenyl)sulfonyl-phenylmethyl]butan-1-ol.
| Compound Name | (2S)-2-[(4-fluorophenyl)sulfonyl-phenylmethyl]butan-1-ol |
|---|---|
| PubChem CID | 164685184 |
| Molecular Formula | C17H19FO3S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (2S)-2-[(4-fluorophenyl)sulfonyl-phenylmethyl]butan-1-ol |
| SMILES | CCC(CO)C(c1ccccc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FO3S/c1-2-13(12-19)17(14-6-4-3-5-7-14)22(20,21)16-10-8-15(18)9-11-16/h3-11,13,17,19H,2,12H2,1H3 |
| InChIKey | RYZSWXHTAYZXLI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |