C21H27FO3S — CID 138375715
(3R)-3-fluoro-8-(4-methylphenyl)sulfonyl-3-phenyloctan-1-ol (PubChem CID 138375715) has the molecular formula C21H27FO3S and a molecular weight of 378.51 g/mol. Its IUPAC name is (3R)-3-fluoro-8-(4-methylphenyl)sulfonyl-3-phenyloctan-1-ol.
| Compound Name | (3R)-3-fluoro-8-(4-methylphenyl)sulfonyl-3-phenyloctan-1-ol |
|---|---|
| PubChem CID | 138375715 |
| Molecular Formula | C21H27FO3S |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (3R)-3-fluoro-8-(4-methylphenyl)sulfonyl-3-phenyloctan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)CCCCC[C@@](F)(CCO)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27FO3S/c1-18-10-12-20(13-11-18)26(24,25)17-7-3-6-14-21(22,15-16-23)19-8-4-2-5-9-19/h2,4-5,8-13,23H,3,6-7,14-17H2,1H3/t21-/m1/s1 |
| InChIKey | RQANEIHFQZKQPO-OAQYLSRUSA-N |
| XLogP | 4.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|