C30H29F17O6S3 — CID 134961153
(2S,3R)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexane-1,6-diol (PubChem CID 134961153) has the molecular formula C30H29F17O6S3 and a molecular weight of 904.72 g/mol. Its IUPAC name is (2S,3R)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexane-1,6-diol.
| Compound Name | (2S,3R)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 134961153 |
| Molecular Formula | C30H29F17O6S3 |
| Molecular Weight | 904.72 g/mol |
| Exact Mass | 904.09 |
| IUPAC Name | (2S,3R)-2-[2,2-bis(benzenesulfonyl)ethyl]-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexane-1,6-diol |
| SMILES | O=S(=O)(c1ccccc1)C(C[C@@H](CO)[C@@H](CCCO)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H29F17O6S3/c31-23(32,24(33,34)25(35,36)26(37,38)27(39,40)28(41,42)29(43,44)30(45,46)47)13-15-54-21(12-7-14-48)18(17-49)16-22(55(50,51)19-8-3-1-4-9-19)56(52,53)20-10-5-2-6-11-20/h1-6,8-11,18,21-22,48-49H,7,12-17H2/t18-,21+/m0/s1 |
| InChIKey | FCZAYSQIWGUCDQ-GHTZIAJQSA-N |
| XLogP | 8.53 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.72 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|