C19H21FO4S — CID 71662018
(Z)-2-[[2-[2-(benzenesulfonyl)ethyl]-5-fluorophenyl]methyl]but-2-ene-1,4-diol (PubChem CID 71662018) has the molecular formula C19H21FO4S and a molecular weight of 364.44 g/mol. Its IUPAC name is (Z)-2-[[2-[2-(benzenesulfonyl)ethyl]-5-fluorophenyl]methyl]but-2-ene-1,4-diol.
| Compound Name | (Z)-2-[[2-[2-(benzenesulfonyl)ethyl]-5-fluorophenyl]methyl]but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 71662018 |
| Molecular Formula | C19H21FO4S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (Z)-2-[[2-[2-(benzenesulfonyl)ethyl]-5-fluorophenyl]methyl]but-2-ene-1,4-diol |
| SMILES | O=S(=O)(CCc1ccc(F)cc1C/C(=C/CO)CO)c1ccccc1 |
| InChI | InChI=1S/C19H21FO4S/c20-18-7-6-16(17(13-18)12-15(14-22)8-10-21)9-11-25(23,24)19-4-2-1-3-5-19/h1-8,13,21-22H,9-12,14H2/b15-8- |
| InChIKey | MHSCBXLJOTUMKY-NVNXTCNLSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|