C14H8F6O3S — CID 13460268
2-(benzenesulfonyl)-2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanol (PubChem CID 13460268) has the molecular formula C14H8F6O3S and a molecular weight of 370.27 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanol.
| Compound Name | 2-(benzenesulfonyl)-2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
|---|---|
| PubChem CID | 13460268 |
| Molecular Formula | C14H8F6O3S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 2-(benzenesulfonyl)-2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
| SMILES | O=S(=O)(c1ccccc1)C(F)C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H8F6O3S/c15-8-7(9(16)11(18)12(19)10(8)17)13(21)14(20)24(22,23)6-4-2-1-3-5-6/h1-5,13-14,21H |
| InChIKey | FPUMNTZPYCBKSC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|