C22H20F2O5S2 — CID 135055116
(3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-(2-fluorophenyl)butan-1-ol (PubChem CID 135055116) has the molecular formula C22H20F2O5S2 and a molecular weight of 466.53 g/mol. Its IUPAC name is (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-(2-fluorophenyl)butan-1-ol.
| Compound Name | (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-(2-fluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 135055116 |
| Molecular Formula | C22H20F2O5S2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-3-(2-fluorophenyl)butan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)([C@@H](CCO)c1ccccc1F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20F2O5S2/c23-21-14-8-7-13-19(21)20(15-16-25)22(24,30(26,27)17-9-3-1-4-10-17)31(28,29)18-11-5-2-6-12-18/h1-14,20,25H,15-16H2/t20-/m0/s1 |
| InChIKey | WKGGHIYFFDZBTI-FQEVSTJZSA-N |
| XLogP | 3.86 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |