C22H20BrFO5S2 — CID 101483660
(3S)-4,4-bis(benzenesulfonyl)-3-(4-bromophenyl)-4-fluorobutan-1-ol (PubChem CID 101483660) has the molecular formula C22H20BrFO5S2 and a molecular weight of 527.43 g/mol. Its IUPAC name is (3S)-4,4-bis(benzenesulfonyl)-3-(4-bromophenyl)-4-fluorobutan-1-ol.
| Compound Name | (3S)-4,4-bis(benzenesulfonyl)-3-(4-bromophenyl)-4-fluorobutan-1-ol |
|---|---|
| PubChem CID | 101483660 |
| Molecular Formula | C22H20BrFO5S2 |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | (3S)-4,4-bis(benzenesulfonyl)-3-(4-bromophenyl)-4-fluorobutan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)([C@@H](CCO)c1ccc(Br)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20BrFO5S2/c23-18-13-11-17(12-14-18)21(15-16-25)22(24,30(26,27)19-7-3-1-4-8-19)31(28,29)20-9-5-2-6-10-20/h1-14,21,25H,15-16H2/t21-/m0/s1 |
| InChIKey | BDPYLSILWDPDGT-NRFANRHFSA-N |
| XLogP | 4.49 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |