C23H23FO5S2 — CID 135070954
5,5-bis(benzenesulfonyl)-5-fluoro-4-phenylpentan-2-ol (PubChem CID 135070954) has the molecular formula C23H23FO5S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 5,5-bis(benzenesulfonyl)-5-fluoro-4-phenylpentan-2-ol.
| Compound Name | 5,5-bis(benzenesulfonyl)-5-fluoro-4-phenylpentan-2-ol |
|---|---|
| PubChem CID | 135070954 |
| Molecular Formula | C23H23FO5S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 5,5-bis(benzenesulfonyl)-5-fluoro-4-phenylpentan-2-ol |
| SMILES | CC(O)CC(c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23FO5S2/c1-18(25)17-22(19-11-5-2-6-12-19)23(24,30(26,27)20-13-7-3-8-14-20)31(28,29)21-15-9-4-10-16-21/h2-16,18,22,25H,17H2,1H3 |
| InChIKey | ZOXJOYCKYCUHGN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |