C22H18BrFO4S2 — CID 44519486
1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-bromobenzene (PubChem CID 44519486) has the molecular formula C22H18BrFO4S2 and a molecular weight of 509.42 g/mol. Its IUPAC name is 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-bromobenzene.
| Compound Name | 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-bromobenzene |
|---|---|
| PubChem CID | 44519486 |
| Molecular Formula | C22H18BrFO4S2 |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-bromobenzene |
| SMILES | C=C[C@@H](c1ccc(Br)cc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18BrFO4S2/c1-2-21(17-13-15-18(23)16-14-17)22(24,29(25,26)19-9-5-3-6-10-19)30(27,28)20-11-7-4-8-12-20/h2-16,21H,1H2/t21-/m0/s1 |
| InChIKey | OJIFRVLSBXYZKS-NRFANRHFSA-N |
| XLogP | 5.29 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|