C25H22Br2F2O2S — CID 135071140
1-[5-(benzenesulfonyl)-2-[(4-bromophenyl)methyl]-5,5-difluoro-3-methylpent-2-enyl]-4-bromobenzene (PubChem CID 135071140) has the molecular formula C25H22Br2F2O2S and a molecular weight of 584.32 g/mol. Its IUPAC name is 1-[5-(benzenesulfonyl)-2-[(4-bromophenyl)methyl]-5,5-difluoro-3-methylpent-2-enyl]-4-bromobenzene.
| Compound Name | 1-[5-(benzenesulfonyl)-2-[(4-bromophenyl)methyl]-5,5-difluoro-3-methylpent-2-enyl]-4-bromobenzene |
|---|---|
| PubChem CID | 135071140 |
| Molecular Formula | C25H22Br2F2O2S |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | 1-[5-(benzenesulfonyl)-2-[(4-bromophenyl)methyl]-5,5-difluoro-3-methylpent-2-enyl]-4-bromobenzene |
| SMILES | CC(CC(F)(F)S(=O)(=O)c1ccccc1)=C(Cc1ccc(Br)cc1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H22Br2F2O2S/c1-18(17-25(28,29)32(30,31)24-5-3-2-4-6-24)21(15-19-7-11-22(26)12-8-19)16-20-9-13-23(27)14-10-20/h2-14H,15-17H2,1H3 |
| InChIKey | NPKCWXIFRMHQHS-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|