C18H20BrFO2S — CID 154714006
1-bromo-4-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]benzene (PubChem CID 154714006) has the molecular formula C18H20BrFO2S and a molecular weight of 399.33 g/mol. Its IUPAC name is 1-bromo-4-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]benzene.
| Compound Name | 1-bromo-4-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]benzene |
|---|---|
| PubChem CID | 154714006 |
| Molecular Formula | C18H20BrFO2S |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 1-bromo-4-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]benzene |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CC(F)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H20BrFO2S/c1-18(2,3)14-6-10-16(11-7-14)23(21,22)12-17(20)13-4-8-15(19)9-5-13/h4-11,17H,12H2,1-3H3 |
| InChIKey | WRYXSYXQWBVQQZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |