C21H16F2O2S — CID 102348345
[3-(benzenesulfonyl)-3,3-difluoro-1-phenylprop-1-enyl]benzene (PubChem CID 102348345) has the molecular formula C21H16F2O2S and a molecular weight of 370.42 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-3,3-difluoro-1-phenylprop-1-enyl]benzene.
| Compound Name | [3-(benzenesulfonyl)-3,3-difluoro-1-phenylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 102348345 |
| Molecular Formula | C21H16F2O2S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [3-(benzenesulfonyl)-3,3-difluoro-1-phenylprop-1-enyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16F2O2S/c22-21(23,26(24,25)19-14-8-3-9-15-19)16-20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-16H |
| InChIKey | RTBBZVSUGMNVNP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |