C16H13BrF2O2S — CID 135070680
1-[4-(benzenesulfonyl)-4,4-difluorobut-1-en-2-yl]-3-bromobenzene (PubChem CID 135070680) has the molecular formula C16H13BrF2O2S and a molecular weight of 387.25 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)-4,4-difluorobut-1-en-2-yl]-3-bromobenzene.
| Compound Name | 1-[4-(benzenesulfonyl)-4,4-difluorobut-1-en-2-yl]-3-bromobenzene |
|---|---|
| PubChem CID | 135070680 |
| Molecular Formula | C16H13BrF2O2S |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 1-[4-(benzenesulfonyl)-4,4-difluorobut-1-en-2-yl]-3-bromobenzene |
| SMILES | C=C(CC(F)(F)S(=O)(=O)c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H13BrF2O2S/c1-12(13-6-5-7-14(17)10-13)11-16(18,19)22(20,21)15-8-3-2-4-9-15/h2-10H,1,11H2 |
| InChIKey | VQJMFGWLWMKJQU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |