C26H27FO4S2 — CID 102163196
1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-(2-methylpropyl)benzene (PubChem CID 102163196) has the molecular formula C26H27FO4S2 and a molecular weight of 486.63 g/mol. Its IUPAC name is 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-(2-methylpropyl)benzene.
| Compound Name | 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 102163196 |
| Molecular Formula | C26H27FO4S2 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-4-(2-methylpropyl)benzene |
| SMILES | C=C[C@@H](c1ccc(CC(C)C)cc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27FO4S2/c1-4-25(22-17-15-21(16-18-22)19-20(2)3)26(27,32(28,29)23-11-7-5-8-12-23)33(30,31)24-13-9-6-10-14-24/h4-18,20,25H,1,19H2,2-3H3/t25-/m0/s1 |
| InChIKey | NWZRYSYHNQMAAV-VWLOTQADSA-N |
| XLogP | 5.73 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|