C28H23FO4S2 — CID 101401558
[(E,3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene (PubChem CID 101401558) has the molecular formula C28H23FO4S2 and a molecular weight of 506.62 g/mol. Its IUPAC name is [(E,3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene.
| Compound Name | [(E,3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene |
|---|---|
| PubChem CID | 101401558 |
| Molecular Formula | C28H23FO4S2 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | [(E,3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)([C@H](/C=C/c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23FO4S2/c29-28(34(30,31)25-17-9-3-10-18-25,35(32,33)26-19-11-4-12-20-26)27(24-15-7-2-8-16-24)22-21-23-13-5-1-6-14-23/h1-22,27H/b22-21+/t27-/m1/s1 |
| InChIKey | RAIPGNPEEVDMSP-MTEPZQBTSA-N |
| XLogP | 6.05 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |