C27H23FO4S2 — CID 135070603
[(2R)-3,3-bis(benzenesulfonyl)-3-fluoro-2-phenylpropyl]benzene (PubChem CID 135070603) has the molecular formula C27H23FO4S2 and a molecular weight of 494.61 g/mol. Its IUPAC name is [(2R)-3,3-bis(benzenesulfonyl)-3-fluoro-2-phenylpropyl]benzene.
| Compound Name | [(2R)-3,3-bis(benzenesulfonyl)-3-fluoro-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 135070603 |
| Molecular Formula | C27H23FO4S2 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [(2R)-3,3-bis(benzenesulfonyl)-3-fluoro-2-phenylpropyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)([C@H](Cc1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23FO4S2/c28-27(33(29,30)24-17-9-3-10-18-24,34(31,32)25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)21-22-13-5-1-6-14-22/h1-20,26H,21H2/t26-/m1/s1 |
| InChIKey | LSJUTIWUHCVPQT-AREMUKBSSA-N |
| XLogP | 5.58 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |