C19H21FO5S2 — CID 135070507
trans-(1R,2R)-2-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-ol (PubChem CID 135070507) has the molecular formula C19H21FO5S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is trans-(1R,2R)-2-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 135070507 |
| Molecular Formula | C19H21FO5S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | trans-(1R,2R)-2-[bis(benzenesulfonyl)-fluoromethyl]cyclohexan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)([C@@H]1CCCC[C@H]1O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21FO5S2/c20-19(17-13-7-8-14-18(17)21,26(22,23)15-9-3-1-4-10-15)27(24,25)16-11-5-2-6-12-16/h1-6,9-12,17-18,21H,7-8,13-14H2/t17-,18-/m1/s1 |
| InChIKey | MMWRLWZZLXQHNZ-QZTJIDSGSA-N |
| XLogP | 3.11 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |