C15H22O2S — CID 14120595
(1S,2R)-2-methyl-1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol (PubChem CID 14120595) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is (1S,2R)-2-methyl-1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol.
| Compound Name | (1S,2R)-2-methyl-1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol |
|---|---|
| PubChem CID | 14120595 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1S,2R)-2-methyl-1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol |
| SMILES | C[C@H](CO)[C@H](O)C1(Sc2ccccc2)CCCC1 |
| InChI | InChI=1S/C15H22O2S/c1-12(11-16)14(17)15(9-5-6-10-15)18-13-7-3-2-4-8-13/h2-4,7-8,12,14,16-17H,5-6,9-11H2,1H3/t12-,14+/m1/s1 |
| InChIKey | ZONMWHBBPWBPAE-OCCSQVGLSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |