C16H24O2S — CID 11242975
1-(1-phenylsulfanylcyclohexyl)butane-1,4-diol (PubChem CID 11242975) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-(1-phenylsulfanylcyclohexyl)butane-1,4-diol.
| Compound Name | 1-(1-phenylsulfanylcyclohexyl)butane-1,4-diol |
|---|---|
| PubChem CID | 11242975 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(1-phenylsulfanylcyclohexyl)butane-1,4-diol |
| SMILES | OCCCC(O)C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C16H24O2S/c17-13-7-10-15(18)16(11-5-2-6-12-16)19-14-8-3-1-4-9-14/h1,3-4,8-9,15,17-18H,2,5-7,10-13H2 |
| InChIKey | YQXMCMHBZCMKAD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |