C14H20O2S — CID 10956055
1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol (PubChem CID 10956055) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol.
| Compound Name | 1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol |
|---|---|
| PubChem CID | 10956055 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-(1-phenylsulfanylcyclopentyl)propane-1,3-diol |
| SMILES | OCCC(O)C1(Sc2ccccc2)CCCC1 |
| InChI | InChI=1S/C14H20O2S/c15-11-8-13(16)14(9-4-5-10-14)17-12-6-2-1-3-7-12/h1-3,6-7,13,15-16H,4-5,8-11H2 |
| InChIKey | BEZLXCDUIRJOMO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |