C18H28O3S — CID 14891605
(4R,5R)-4-[1-(benzenesulfonyl)ethenyl]decan-5-ol (PubChem CID 14891605) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is (4R,5R)-4-[1-(benzenesulfonyl)ethenyl]decan-5-ol.
| Compound Name | (4R,5R)-4-[1-(benzenesulfonyl)ethenyl]decan-5-ol |
|---|---|
| PubChem CID | 14891605 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (4R,5R)-4-[1-(benzenesulfonyl)ethenyl]decan-5-ol |
| SMILES | C=C([C@H](CCC)[C@H](O)CCCCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O3S/c1-4-6-8-14-18(19)17(11-5-2)15(3)22(20,21)16-12-9-7-10-13-16/h7,9-10,12-13,17-19H,3-6,8,11,14H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | RGVKYQZDUDLXHW-ZWKOTPCHSA-N |
| XLogP | 4.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|