C16H22O3S — CID 164890335
(1S,2S,3S,5S)-3-(benzenesulfonyl)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 164890335) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (1S,2S,3S,5S)-3-(benzenesulfonyl)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,3S,5S)-3-(benzenesulfonyl)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 164890335 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (1S,2S,3S,5S)-3-(benzenesulfonyl)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@H]1C[C@H](O)[C@H](C)[C@@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H22O3S/c1-11(2)13-9-15(17)12(3)16(10-13)20(18,19)14-7-5-4-6-8-14/h4-8,12-13,15-17H,1,9-10H2,2-3H3/t12-,13-,15-,16-/m0/s1 |
| InChIKey | USZRTTOILCSAAM-SDADXPQNSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|