C44H76O7S2Si2 — CID 11104839
(2S,3R,4S,10S,11S,14S)-1,9-bis(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-ol (PubChem CID 11104839) has the molecular formula C44H76O7S2Si2 and a molecular weight of 837.39 g/mol. Its IUPAC name is (2S,3R,4S,10S,11S,14S)-1,9-bis(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-ol.
| Compound Name | (2S,3R,4S,10S,11S,14S)-1,9-bis(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-ol |
|---|---|
| PubChem CID | 11104839 |
| Molecular Formula | C44H76O7S2Si2 |
| Molecular Weight | 837.39 g/mol |
| Exact Mass | 836.46 |
| IUPAC Name | (2S,3R,4S,10S,11S,14S)-1,9-bis(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-ol |
| SMILES | C=C[C@@H](C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(CC(O)CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CS(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C44H76O7S2Si2/c1-16-33(2)27-30-40(50-54(12,13)43(6,7)8)36(5)41(53(48,49)39-25-21-18-22-26-39)31-37(45)29-28-34(3)42(51-55(14,15)44(9,10)11)35(4)32-52(46,47)38-23-19-17-20-24-38/h16-26,33-37,40-42,45H,1,27-32H2,2-15H3/t33-,34+,35-,36+,37?,40+,41?,42-/m1/s1 |
| InChIKey | XIYUSFJWUYFYOG-UJGNUUFASA-N |
| XLogP | 11.13 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.39 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|