C22H38O4SSi — CID 11133706
[(2S,3R,4S)-1-(benzenesulfonyl)-2,4-dimethyl-6-(oxiran-2-yl)hexan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11133706) has the molecular formula C22H38O4SSi and a molecular weight of 426.70 g/mol. Its IUPAC name is [(2S,3R,4S)-1-(benzenesulfonyl)-2,4-dimethyl-6-(oxiran-2-yl)hexan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,4S)-1-(benzenesulfonyl)-2,4-dimethyl-6-(oxiran-2-yl)hexan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11133706 |
| Molecular Formula | C22H38O4SSi |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [(2S,3R,4S)-1-(benzenesulfonyl)-2,4-dimethyl-6-(oxiran-2-yl)hexan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCC1CO1 |
| InChI | InChI=1S/C22H38O4SSi/c1-17(13-14-19-15-25-19)21(26-28(6,7)22(3,4)5)18(2)16-27(23,24)20-11-9-8-10-12-20/h8-12,17-19,21H,13-16H2,1-7H3/t17-,18+,19?,21+/m0/s1 |
| InChIKey | UGJKNGLGLUOJOU-GPXSZDCPSA-N |
| XLogP | 5.30 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|