C20H36O4S2Si — CID 134880530
[(2S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylsulfanylhexan-2-yl] methanesulfonate (PubChem CID 134880530) has the molecular formula C20H36O4S2Si and a molecular weight of 432.72 g/mol. Its IUPAC name is [(2S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylsulfanylhexan-2-yl] methanesulfonate.
| Compound Name | [(2S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylsulfanylhexan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 134880530 |
| Molecular Formula | C20H36O4S2Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(2S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylsulfanylhexan-2-yl] methanesulfonate |
| SMILES | C[C@@H](CCSc1ccccc1)C[C@@H](CO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C20H36O4S2Si/c1-17(13-14-25-19-11-9-8-10-12-19)15-18(24-26(5,21)22)16-23-27(6,7)20(2,3)4/h8-12,17-18H,13-16H2,1-7H3/t17-,18-/m0/s1 |
| InChIKey | YLMKDVHWRCKUOO-ROUUACIJSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|