C21H36O4SSi — CID 134936211
[1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tri(propan-2-yl)silane (PubChem CID 134936211) has the molecular formula C21H36O4SSi and a molecular weight of 412.67 g/mol. Its IUPAC name is [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tri(propan-2-yl)silane.
| Compound Name | [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134936211 |
| Molecular Formula | C21H36O4SSi |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)C(O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H36O4SSi/c1-14(2)19(25-27(15(3)4,16(5)6)17(7)8)20-21(24-20)26(22,23)18-12-10-9-11-13-18/h9-17,19-21H,1-8H3/t19?,20-,21-/m1/s1 |
| InChIKey | IDGBSSIWXWOIEY-RWLBOTFQSA-N |
| XLogP | 5.40 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|