C24H40O5SSi — CID 134936858
[(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134936858) has the molecular formula C24H40O5SSi and a molecular weight of 468.73 g/mol. Its IUPAC name is [(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134936858 |
| Molecular Formula | C24H40O5SSi |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1CCCO[C@]12O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H40O5SSi/c1-18-16-22(30(25,26)20-13-9-8-10-14-20)24(19(2)12-11-15-27-24)29-21(18)17-28-31(6,7)23(3,4)5/h8-10,13-14,18-19,21-22H,11-12,15-17H2,1-7H3/t18-,19+,21+,22+,24-/m0/s1 |
| InChIKey | UEIKNYDSONTKPS-SIPPMDTESA-N |
| XLogP | 5.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|